C20H31ClNO4- — CID 53352733
ethyl 1-[2-hydroxy-3-(1-phenylpropoxy)propyl]piperidine-4-carboxylate chloride (PubChem CID 53352733) has the molecular formula C20H31ClNO4- and a molecular weight of 384.92 g/mol. Its IUPAC name is ethyl 1-[2-hydroxy-3-(1-phenylpropoxy)propyl]piperidine-4-carboxylate chloride.
| Compound Name | ethyl 1-[2-hydroxy-3-(1-phenylpropoxy)propyl]piperidine-4-carboxylate chloride |
|---|---|
| PubChem CID | 53352733 |
| Molecular Formula | C20H31ClNO4- |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl 1-[2-hydroxy-3-(1-phenylpropoxy)propyl]piperidine-4-carboxylate chloride |
| SMILES | CCOC(=O)C1CCN(CC(O)COC(CC)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C20H31NO4.ClH/c1-3-19(16-8-6-5-7-9-16)25-15-18(22)14-21-12-10-17(11-13-21)20(23)24-4-2;/h5-9,17-19,22H,3-4,10-15H2,1-2H3;1H/p-1 |
| InChIKey | SNSBCZSVCNGJRT-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |