C21H33NO4 — CID 3357686
ethyl 1-[2-hydroxy-3-(3-methyl-5-propan-2-ylphenoxy)propyl]piperidine-4-carboxylate (PubChem CID 3357686) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethyl 1-[2-hydroxy-3-(3-methyl-5-propan-2-ylphenoxy)propyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-hydroxy-3-(3-methyl-5-propan-2-ylphenoxy)propyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3357686 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | ethyl 1-[2-hydroxy-3-(3-methyl-5-propan-2-ylphenoxy)propyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(O)COc2cc(C)cc(C(C)C)c2)CC1 |
| InChI | InChI=1S/C21H33NO4/c1-5-25-21(24)17-6-8-22(9-7-17)13-19(23)14-26-20-11-16(4)10-18(12-20)15(2)3/h10-12,15,17,19,23H,5-9,13-14H2,1-4H3 |
| InChIKey | UBRDAWJOQPBECE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |