C31H40F3N5O6 — CID 53353871
(2S,4S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]-4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-2-carboxylic acid (PubChem CID 53353871) has the molecular formula C31H40F3N5O6 and a molecular weight of 635.68 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]-4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]-4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 53353871 |
| Molecular Formula | C31H40F3N5O6 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | (2S,4S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]-4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1C[C@@H](NC(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)C[C@H]1C(=O)O |
| InChI | InChI=1S/C31H40F3N5O6/c32-22-16-24(34)23(33)13-19(22)12-20(36)14-28(40)37-21-15-27(31(44)45)39(17-21)29(41)25(8-4-5-11-35)38-26(30(42)43)10-9-18-6-2-1-3-7-18/h1-3,6-7,13,16,20-21,25-27,38H,4-5,8-12,14-15,17,35-36H2,(H,37,40)(H,42,43)(H,44,45)/t20-,21+,25+,26+,27+/m1/s1 |
| InChIKey | YYSCEUHROJAHSR-PYVLESRRSA-N |
| XLogP | 1.71 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|