C21H21F2N7S — CID 53354016
8-(3,4-difluorophenyl)-6-methyl-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 53354016) has the molecular formula C21H21F2N7S and a molecular weight of 441.51 g/mol. Its IUPAC name is 8-(3,4-difluorophenyl)-6-methyl-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(3,4-difluorophenyl)-6-methyl-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 53354016 |
| Molecular Formula | C21H21F2N7S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 8-(3,4-difluorophenyl)-6-methyl-N-[1-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(-c2ccc(F)c(F)c2)c2nc(NC3CCN(c4nc(C)ns4)CC3)nn2c1 |
| InChI | InChI=1S/C21H21F2N7S/c1-12-9-16(14-3-4-17(22)18(23)10-14)19-26-20(27-30(19)11-12)25-15-5-7-29(8-6-15)21-24-13(2)28-31-21/h3-4,9-11,15H,5-8H2,1-2H3,(H,25,27) |
| InChIKey | HEGMUPVUSWJQHE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |