C20H21N5O3S3 — CID 53356437
1-methyl-N-(2-methylsulfanylethyl)-2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide (PubChem CID 53356437) has the molecular formula C20H21N5O3S3 and a molecular weight of 475.62 g/mol. Its IUPAC name is 1-methyl-N-(2-methylsulfanylethyl)-2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide.
| Compound Name | 1-methyl-N-(2-methylsulfanylethyl)-2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 53356437 |
| Molecular Formula | C20H21N5O3S3 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 1-methyl-N-(2-methylsulfanylethyl)-2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide |
| SMILES | CSCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(S(C)(=O)=O)cc3s1)n2C |
| InChI | InChI=1S/C20H21N5O3S3/c1-25-16-7-4-12(18(26)21-8-9-29-2)10-15(16)22-19(25)24-20-23-14-6-5-13(31(3,27)28)11-17(14)30-20/h4-7,10-11H,8-9H2,1-3H3,(H,21,26)(H,22,23,24) |
| InChIKey | GYIBCHQVHOBWHM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|