C18H27FN2O2S — CID 53361019
1-[2-[(2R)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]ethyl]-4-methylpiperidine (PubChem CID 53361019) has the molecular formula C18H27FN2O2S and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-[2-[(2R)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]ethyl]-4-methylpiperidine.
| Compound Name | 1-[2-[(2R)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 53361019 |
| Molecular Formula | C18H27FN2O2S |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[2-[(2R)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]ethyl]-4-methylpiperidine |
| SMILES | CC1CCN(CC[C@H]2CCCN2S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN2O2S/c1-15-8-12-20(13-9-15)14-10-17-3-2-11-21(17)24(22,23)18-6-4-16(19)5-7-18/h4-7,15,17H,2-3,8-14H2,1H3/t17-/m1/s1 |
| InChIKey | NDJDDJXIOFVXRI-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |