C18H23N7O3 — CID 53361477
N-[1-[(4-azidophenyl)methyl]pyrazol-4-yl]-N'-hydroxyoctanediamide (PubChem CID 53361477) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[1-[(4-azidophenyl)methyl]pyrazol-4-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[1-[(4-azidophenyl)methyl]pyrazol-4-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 53361477 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[1-[(4-azidophenyl)methyl]pyrazol-4-yl]-N'-hydroxyoctanediamide |
| SMILES | [N-]=[N+]=Nc1ccc(Cn2cc(NC(=O)CCCCCCC(=O)NO)cn2)cc1 |
| InChI | InChI=1S/C18H23N7O3/c19-24-22-15-9-7-14(8-10-15)12-25-13-16(11-20-25)21-17(26)5-3-1-2-4-6-18(27)23-28/h7-11,13,28H,1-6,12H2,(H,21,26)(H,23,27) |
| InChIKey | DBHSJTPWMOAAAA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|