About 4-azido-1-benzylpyrazole
4-azido-1-benzylpyrazole (PubChem CID 57301951) has the molecular formula C10H9N5
and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-azido-1-benzylpyrazole.
Molecular Properties
| Compound Name | 4-azido-1-benzylpyrazole |
| PubChem CID | 57301951 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-azido-1-benzylpyrazole |
| SMILES | [N-]=[N+]=Nc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C10H9N5/c11-14-13-10-6-12-15(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2 |
| InChIKey | DTSDAQIUPLCHOQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-1-benzylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-1-benzylpyrazole?
The IUPAC name of 4-azido-1-benzylpyrazole (CID 57301951) is 4-azido-1-benzylpyrazole.
What is the SMILES notation for 4-azido-1-benzylpyrazole?
The canonical SMILES for 4-azido-1-benzylpyrazole is [N-]=[N+]=Nc1cnn(Cc2ccccc2)c1.
What is the InChIKey of 4-azido-1-benzylpyrazole?
The InChIKey is DTSDAQIUPLCHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5/c11-14-13-10-6-12-15(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2.
What are the key properties of 4-azido-1-benzylpyrazole?
4-azido-1-benzylpyrazole has a molecular weight of 199.22 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-1-benzylpyrazole is sourced from PubChem (CID 57301951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).