C22H23N7O2 — CID 53362167
N-[3-[[4-(4-benzoylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 53362167) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[3-[[4-(4-benzoylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-(4-benzoylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 53362167 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[3-[[4-(4-benzoylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCN(C(=O)c4ccccc4)CC3)n2)c1 |
| InChI | InChI=1S/C22H23N7O2/c1-16(30)25-18-8-5-9-19(14-18)26-21-23-15-24-22(27-21)29-12-10-28(11-13-29)20(31)17-6-3-2-4-7-17/h2-9,14-15H,10-13H2,1H3,(H,25,30)(H,23,24,26,27) |
| InChIKey | BKYMGPJHTCDMHJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |