C14H26O7 — CID 53362385
(E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enal (PubChem CID 53362385) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enal.
| Compound Name | (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enal |
|---|---|
| PubChem CID | 53362385 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (E,5R,6R,7R)-5,6,7-tris(methoxymethoxy)oct-2-enal |
| SMILES | COCO[C@H]([C@@H](C)OCOC)[C@@H](C/C=C/C=O)OCOC |
| InChI | InChI=1S/C14H26O7/c1-12(19-9-16-2)14(21-11-18-4)13(20-10-17-3)7-5-6-8-15/h5-6,8,12-14H,7,9-11H2,1-4H3/b6-5+/t12-,13-,14-/m1/s1 |
| InChIKey | DNXOUSKHGAJJQK-LHHWMGCDSA-N |
| XLogP | 1.12 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|