C18H30O8 — CID 53362388
(2R)-2-[(E,4R,5R,6R)-4,5,6-tris(methoxymethoxy)hept-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 53362388) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is (2R)-2-[(E,4R,5R,6R)-4,5,6-tris(methoxymethoxy)hept-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E,4R,5R,6R)-4,5,6-tris(methoxymethoxy)hept-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 53362388 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2R)-2-[(E,4R,5R,6R)-4,5,6-tris(methoxymethoxy)hept-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | COCO[C@H]([C@@H](C)OCOC)[C@@H](C/C=C/[C@H]1CC=CC(=O)O1)OCOC |
| InChI | InChI=1S/C18H30O8/c1-14(23-11-20-2)18(25-13-22-4)16(24-12-21-3)9-5-7-15-8-6-10-17(19)26-15/h5-7,10,14-16,18H,8-9,11-13H2,1-4H3/b7-5+/t14-,15+,16-,18-/m1/s1 |
| InChIKey | GVGVKOOXRGDGIR-ZKKLDNFUSA-N |
| XLogP | 1.79 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|