C19H9ClF3N3 — CID 53363414
1-chloro-3-[4-(trifluoromethyl)phenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 53363414) has the molecular formula C19H9ClF3N3 and a molecular weight of 371.75 g/mol. Its IUPAC name is 1-chloro-3-[4-(trifluoromethyl)phenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-chloro-3-[4-(trifluoromethyl)phenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 53363414 |
| Molecular Formula | C19H9ClF3N3 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-chloro-3-[4-(trifluoromethyl)phenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(C(F)(F)F)cc2)cc(Cl)n2c1nc1ccccc12 |
| InChI | InChI=1S/C19H9ClF3N3/c20-17-9-13(11-5-7-12(8-6-11)19(21,22)23)14(10-24)18-25-15-3-1-2-4-16(15)26(17)18/h1-9H |
| InChIKey | VGKBGSHXSWJXDQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|