C16H11F3N2O — CID 53363540
8-(trifluoromethyl)-1,3,4,6-tetrahydropyrido[3,2-b]carbazol-2-one (PubChem CID 53363540) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 8-(trifluoromethyl)-1,3,4,6-tetrahydropyrido[3,2-b]carbazol-2-one.
| Compound Name | 8-(trifluoromethyl)-1,3,4,6-tetrahydropyrido[3,2-b]carbazol-2-one |
|---|---|
| PubChem CID | 53363540 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 8-(trifluoromethyl)-1,3,4,6-tetrahydropyrido[3,2-b]carbazol-2-one |
| SMILES | O=C1CCc2cc3[nH]c4cc(C(F)(F)F)ccc4c3cc2N1 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)9-2-3-10-11-7-12-8(1-4-15(22)21-12)5-13(11)20-14(10)6-9/h2-3,5-7,20H,1,4H2,(H,21,22) |
| InChIKey | VWSWNLZTAHDXEE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |