About 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine
1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine (PubChem CID 53364061) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 53364061 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1c(C(C)(C)C)[nH]c2ncccc12 |
| InChI | InChI=1S/C14H21N3/c1-14(2,3)12-11(9-17(4)5)10-7-6-8-15-13(10)16-12/h6-8H,9H2,1-5H3,(H,15,16) |
| InChIKey | JAYNWOJYHLJOTJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine (CID 53364061) is 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine is CN(C)Cc1c(C(C)(C)C)[nH]c2ncccc12.
What is the InChIKey of 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine?
The InChIKey is JAYNWOJYHLJOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-14(2,3)12-11(9-17(4)5)10-7-6-8-15-13(10)16-12/h6-8H,9H2,1-5H3,(H,15,16).
What are the key properties of 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine?
1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine has a molecular weight of 231.34 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 53364061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).