C16H27N3O2S — CID 53365616
2-(cyclohexylamino)-N-(3-ethoxypropyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 53365616) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-(3-ethoxypropyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-(3-ethoxypropyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53365616 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-(cyclohexylamino)-N-(3-ethoxypropyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOCCCNC(=O)c1sc(NC2CCCCC2)nc1C |
| InChI | InChI=1S/C16H27N3O2S/c1-3-21-11-7-10-17-15(20)14-12(2)18-16(22-14)19-13-8-5-4-6-9-13/h13H,3-11H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | OPGBLXXDGCYXTO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|