C28H34N4O3 — CID 53367115
1-[6-(4-ethylphenoxy)pyrimidin-4-yl]-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 53367115) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-[6-(4-ethylphenoxy)pyrimidin-4-yl]-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[6-(4-ethylphenoxy)pyrimidin-4-yl]-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53367115 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-[6-(4-ethylphenoxy)pyrimidin-4-yl]-N-[(4-propoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCCOc1ccc(CNC(=O)C2CCN(c3cc(Oc4ccc(CC)cc4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-3-17-34-24-9-7-22(8-10-24)19-29-28(33)23-13-15-32(16-14-23)26-18-27(31-20-30-26)35-25-11-5-21(4-2)6-12-25/h5-12,18,20,23H,3-4,13-17,19H2,1-2H3,(H,29,33) |
| InChIKey | SRHARUPMYKTGLJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |