C20H21N3O3S — CID 53367825
N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-indol-1-ylacetamide (PubChem CID 53367825) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-indol-1-ylacetamide.
| Compound Name | N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-indol-1-ylacetamide |
|---|---|
| PubChem CID | 53367825 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[4-(1,1-dioxothiazinan-2-yl)phenyl]-2-indol-1-ylacetamide |
| SMILES | O=C(Cn1ccc2ccccc21)Nc1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c24-20(15-22-13-11-16-5-1-2-6-19(16)22)21-17-7-9-18(10-8-17)23-12-3-4-14-27(23,25)26/h1-2,5-11,13H,3-4,12,14-15H2,(H,21,24) |
| InChIKey | AZSSXNGJODTCOH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |