C25H23N3O2 — CID 53368720
3-(3,3-diphenylpropylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 53368720) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(3,3-diphenylpropylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,3-diphenylpropylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53368720 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-(3,3-diphenylpropylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCC(c2ccccc2)c2ccccc2)c(NCc2ccccn2)c1=O |
| InChI | InChI=1S/C25H23N3O2/c29-24-22(23(25(24)30)28-17-20-13-7-8-15-26-20)27-16-14-21(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-13,15,21,27-28H,14,16-17H2 |
| InChIKey | DKBNFBBEJLYQDV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|