C19H17N3O4 — CID 162672166
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 162672166) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 162672166 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccccn2)c(Nc2ccc3c(c2)OCCCO3)c1=O |
| InChI | InChI=1S/C19H17N3O4/c23-18-16(21-11-13-4-1-2-7-20-13)17(19(18)24)22-12-5-6-14-15(10-12)26-9-3-8-25-14/h1-2,4-7,10,21-22H,3,8-9,11H2 |
| InChIKey | KVPDTPGHOWGXHM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|