C21H25N5O2 — CID 53368927
3-(4-benzylpiperazin-1-yl)-4-[2-(3-methylpyrazol-1-yl)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 53368927) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-4-[2-(3-methylpyrazol-1-yl)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-4-[2-(3-methylpyrazol-1-yl)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53368927 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-4-[2-(3-methylpyrazol-1-yl)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccn(CCNc2c(N3CCN(Cc4ccccc4)CC3)c(=O)c2=O)n1 |
| InChI | InChI=1S/C21H25N5O2/c1-16-7-9-26(23-16)10-8-22-18-19(21(28)20(18)27)25-13-11-24(12-14-25)15-17-5-3-2-4-6-17/h2-7,9,22H,8,10-15H2,1H3 |
| InChIKey | XRYLKDIJADDZNP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|