C23H29N5O2 — CID 53367643
3-(4-benzylpiperazin-1-yl)-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 53367643) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53367643 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1nn(C)c(C)c1CCNc1c(N2CCN(Cc3ccccc3)CC2)c(=O)c1=O |
| InChI | InChI=1S/C23H29N5O2/c1-16-19(17(2)26(3)25-16)9-10-24-20-21(23(30)22(20)29)28-13-11-27(12-14-28)15-18-7-5-4-6-8-18/h4-8,24H,9-15H2,1-3H3 |
| InChIKey | XJANUMSQBLTHIF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|