C17H21N5 — CID 112718326
1-benzyl-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]triazole (PubChem CID 112718326) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-benzyl-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]triazole.
| Compound Name | 1-benzyl-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]triazole |
|---|---|
| PubChem CID | 112718326 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-benzyl-4-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]triazole |
| SMILES | Cc1nn(C)c(C)c1CCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H21N5/c1-13-17(14(2)21(3)19-13)10-9-16-12-22(20-18-16)11-15-7-5-4-6-8-15/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | XIAMNAXNEYOHBI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |