C17H22N4O4 — CID 53370200
3-[(2-hydroxy-3-morpholin-4-ylpropyl)amino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 53370200) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-morpholin-4-ylpropyl)amino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-hydroxy-3-morpholin-4-ylpropyl)amino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53370200 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[(2-hydroxy-3-morpholin-4-ylpropyl)amino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccccn2)c(NCC(O)CN2CCOCC2)c1=O |
| InChI | InChI=1S/C17H22N4O4/c22-13(11-21-5-7-25-8-6-21)10-20-15-14(16(23)17(15)24)19-9-12-3-1-2-4-18-12/h1-4,13,19-20,22H,5-11H2 |
| InChIKey | ZOZNEQLMSPKFCQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|