C19H17N3O2 — CID 53371968
2-[[ethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 53371968) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[[ethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[[ethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 53371968 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[[ethyl(methyl)amino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | CCN(C)Cc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H17N3O2/c1-3-22(2)10-15-20-14-9-8-13-16(17(14)21-15)19(24)12-7-5-4-6-11(12)18(13)23/h4-9H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | WWXKIYNBYXFAJS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|