C18H11ClFN5 — CID 53373517
2-(5-chloro-2-fluorophenyl)-N-pyrimidin-4-yl-1,8-naphthyridin-4-amine (PubChem CID 53373517) has the molecular formula C18H11ClFN5 and a molecular weight of 351.77 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-pyrimidin-4-yl-1,8-naphthyridin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-pyrimidin-4-yl-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 53373517 |
| Molecular Formula | C18H11ClFN5 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-pyrimidin-4-yl-1,8-naphthyridin-4-amine |
| SMILES | Fc1ccc(Cl)cc1-c1cc(Nc2ccncn2)c2cccnc2n1 |
| InChI | InChI=1S/C18H11ClFN5/c19-11-3-4-14(20)13(8-11)16-9-15(24-17-5-7-21-10-23-17)12-2-1-6-22-18(12)25-16/h1-10H,(H,21,22,23,24,25) |
| InChIKey | GRCOAEMKVHMLFN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |