About 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine
2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine (PubChem CID 88913140) has the molecular formula C19H11Cl2FN4
and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine.
Molecular Properties
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine |
| PubChem CID | 88913140 |
| Molecular Formula | C19H11Cl2FN4 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine |
| SMILES | Fc1ccc(Cl)cc1-c1cc(Nc2ccnc(Cl)c2)c2cccnc2n1 |
| InChI | InChI=1S/C19H11Cl2FN4/c20-11-3-4-15(22)14(8-11)17-10-16(13-2-1-6-24-19(13)26-17)25-12-5-7-23-18(21)9-12/h1-10H,(H,23,24,25,26) |
| InChIKey | JOWDWCGCNXGGEV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine?
The IUPAC name of 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine (CID 88913140) is 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine.
What is the SMILES notation for 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine?
The canonical SMILES for 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine is Fc1ccc(Cl)cc1-c1cc(Nc2ccnc(Cl)c2)c2cccnc2n1.
What is the InChIKey of 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine?
The InChIKey is JOWDWCGCNXGGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl2FN4/c20-11-3-4-15(22)14(8-11)17-10-16(13-2-1-6-24-19(13)26-17)25-12-5-7-23-18(21)9-12/h1-10H,(H,23,24,25,26).
What are the key properties of 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine?
2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine has a molecular weight of 385.23 g/mol, XLogP of 5.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-fluorophenyl)-N-(2-chloro-4-pyridinyl)-1,8-naphthyridin-4-amine is sourced from PubChem (CID 88913140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).