C23H19NOS — CID 53375520
2-dibenzothiophen-2-yl-7,7-dimethyl-6,8-dihydroquinolin-5-one (PubChem CID 53375520) has the molecular formula C23H19NOS and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-dibenzothiophen-2-yl-7,7-dimethyl-6,8-dihydroquinolin-5-one.
| Compound Name | 2-dibenzothiophen-2-yl-7,7-dimethyl-6,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 53375520 |
| Molecular Formula | C23H19NOS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-dibenzothiophen-2-yl-7,7-dimethyl-6,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)c2ccc(-c3ccc4sc5ccccc5c4c3)nc2C1 |
| InChI | InChI=1S/C23H19NOS/c1-23(2)12-19-16(20(25)13-23)8-9-18(24-19)14-7-10-22-17(11-14)15-5-3-4-6-21(15)26-22/h3-11H,12-13H2,1-2H3 |
| InChIKey | UCLQNOGIVLXVKT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |