C15H15NOS — CID 53375549
6,6-dimethyl-2-thiophen-2-yl-7,8-dihydroquinolin-5-one (PubChem CID 53375549) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is 6,6-dimethyl-2-thiophen-2-yl-7,8-dihydroquinolin-5-one.
| Compound Name | 6,6-dimethyl-2-thiophen-2-yl-7,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 53375549 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 6,6-dimethyl-2-thiophen-2-yl-7,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CCc2nc(-c3cccs3)ccc2C1=O |
| InChI | InChI=1S/C15H15NOS/c1-15(2)8-7-11-10(14(15)17)5-6-12(16-11)13-4-3-9-18-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | LLJCPXDJNHPJHV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |