C7H8Cl2O3 — CID 53375845
(1R,4S,5S)-6,7-dichloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 53375845) has the molecular formula C7H8Cl2O3 and a molecular weight of 211.04 g/mol. Its IUPAC name is (1R,4S,5S)-6,7-dichloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1R,4S,5S)-6,7-dichloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 53375845 |
| Molecular Formula | C7H8Cl2O3 |
| Molecular Weight | 211.04 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | (1R,4S,5S)-6,7-dichloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | O=C1O[C@H](CO)[C@H]2C(Cl)C(Cl)[C@@H]12 |
| InChI | InChI=1S/C7H8Cl2O3/c8-5-3-2(1-10)12-7(11)4(3)6(5)9/h2-6,10H,1H2/t2-,3-,4+,5?,6?/m1/s1 |
| InChIKey | OCABQTRGJTZLJF-MNQXGKBZSA-N |
| XLogP | 0.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.04 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|