C7H9ClO3 — CID 53375850
(1S,4S,5R)-1-chloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 53375850) has the molecular formula C7H9ClO3 and a molecular weight of 176.60 g/mol. Its IUPAC name is (1S,4S,5R)-1-chloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1S,4S,5R)-1-chloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 53375850 |
| Molecular Formula | C7H9ClO3 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | (1S,4S,5R)-1-chloro-4-(hydroxymethyl)-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | O=C1O[C@H](CO)[C@H]2CC[C@@]12Cl |
| InChI | InChI=1S/C7H9ClO3/c8-7-2-1-4(7)5(3-9)11-6(7)10/h4-5,9H,1-3H2/t4-,5-,7+/m1/s1 |
| InChIKey | ZGYOBHWYTXXQBI-XAHCXIQSSA-N |
| XLogP | 0.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|