C23H14F3N3O — CID 53375930
2,7-diphenyl-3-prop-2-ynyl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 53375930) has the molecular formula C23H14F3N3O and a molecular weight of 405.38 g/mol. Its IUPAC name is 2,7-diphenyl-3-prop-2-ynyl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2,7-diphenyl-3-prop-2-ynyl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 53375930 |
| Molecular Formula | C23H14F3N3O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2,7-diphenyl-3-prop-2-ynyl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | C#CCn1c(-c2ccccc2)nc2nc(-c3ccccc3)cc(C(F)(F)F)c2c1=O |
| InChI | InChI=1S/C23H14F3N3O/c1-2-13-29-21(16-11-7-4-8-12-16)28-20-19(22(29)30)17(23(24,25)26)14-18(27-20)15-9-5-3-6-10-15/h1,3-12,14H,13H2 |
| InChIKey | FUZGZYXUVCUQPN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|