C16H12F3N3O — CID 25096279
6-[(3,3-difluorocyclobutyl)amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25096279) has the molecular formula C16H12F3N3O and a molecular weight of 319.29 g/mol. Its IUPAC name is 6-[(3,3-difluorocyclobutyl)amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-[(3,3-difluorocyclobutyl)amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25096279 |
| Molecular Formula | C16H12F3N3O |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-[(3,3-difluorocyclobutyl)amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2nc(NC3CC(F)(F)C3)c3ccc(F)cc3c12 |
| InChI | InChI=1S/C16H12F3N3O/c17-8-1-2-10-11(5-8)13-12(3-4-20-15(13)23)22-14(10)21-9-6-16(18,19)7-9/h1-5,9H,6-7H2,(H,20,23)(H,21,22) |
| InChIKey | ASPDEPIEGDDDCD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|