C17H18FN3O — CID 25096020
9-fluoro-6-[[(2S)-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25096020) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 9-fluoro-6-[[(2S)-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-fluoro-6-[[(2S)-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25096020 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 9-fluoro-6-[[(2S)-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(C)[C@H](C)Nc1nc2cc[nH]c(=O)c2c2cc(F)ccc12 |
| InChI | InChI=1S/C17H18FN3O/c1-9(2)10(3)20-16-12-5-4-11(18)8-13(12)15-14(21-16)6-7-19-17(15)22/h4-10H,1-3H3,(H,19,22)(H,20,21)/t10-/m0/s1 |
| InChIKey | PKCJWSFDRJQONO-JTQLQIEISA-N |
| XLogP | 3.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|