C24H23ClO4 — CID 53376359
1-(4-chlorophenyl)-2-[2-methyl-4-(oxan-2-yloxy)naphthalen-1-yl]oxyethanone (PubChem CID 53376359) has the molecular formula C24H23ClO4 and a molecular weight of 410.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[2-methyl-4-(oxan-2-yloxy)naphthalen-1-yl]oxyethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[2-methyl-4-(oxan-2-yloxy)naphthalen-1-yl]oxyethanone |
|---|---|
| PubChem CID | 53376359 |
| Molecular Formula | C24H23ClO4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[2-methyl-4-(oxan-2-yloxy)naphthalen-1-yl]oxyethanone |
| SMILES | Cc1cc(OC2CCCCO2)c2ccccc2c1OCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClO4/c1-16-14-22(29-23-8-4-5-13-27-23)19-6-2-3-7-20(19)24(16)28-15-21(26)17-9-11-18(25)12-10-17/h2-3,6-7,9-12,14,23H,4-5,8,13,15H2,1H3 |
| InChIKey | RRJTXGQIWRHHBO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |