C13H23ClO3Si — CID 53376403
(1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-chloro-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 53376403) has the molecular formula C13H23ClO3Si and a molecular weight of 290.86 g/mol. Its IUPAC name is (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-chloro-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-chloro-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 53376403 |
| Molecular Formula | C13H23ClO3Si |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (1S,4S,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-chloro-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@]2(Cl)CC[C@H]12 |
| InChI | InChI=1S/C13H23ClO3Si/c1-12(2,3)18(4,5)16-8-10-9-6-7-13(9,14)11(15)17-10/h9-10H,6-8H2,1-5H3/t9-,10-,13+/m1/s1 |
| InChIKey | IBJIOVRVTDHAPY-BREBYQMCSA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|