C14H12ClN3O — CID 53376674
3-(2-chloroethyl)-8-methylpyrimido[5,4-c]quinolin-4-one (PubChem CID 53376674) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-(2-chloroethyl)-8-methylpyrimido[5,4-c]quinolin-4-one.
| Compound Name | 3-(2-chloroethyl)-8-methylpyrimido[5,4-c]quinolin-4-one |
|---|---|
| PubChem CID | 53376674 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-(2-chloroethyl)-8-methylpyrimido[5,4-c]quinolin-4-one |
| SMILES | Cc1ccc2c(c1)ncc1c(=O)n(CCCl)cnc12 |
| InChI | InChI=1S/C14H12ClN3O/c1-9-2-3-10-12(6-9)16-7-11-13(10)17-8-18(5-4-15)14(11)19/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | XDKBVMBVWUQNCH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|