C25H29Cl2N5O2 — CID 90664947
3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-9-methylpyrimido[5,4-c]quinolin-4-one;dihydrochloride (PubChem CID 90664947) has the molecular formula C25H29Cl2N5O2 and a molecular weight of 502.45 g/mol. Its IUPAC name is 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-9-methylpyrimido[5,4-c]quinolin-4-one;dihydrochloride.
| Compound Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-9-methylpyrimido[5,4-c]quinolin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 90664947 |
| Molecular Formula | C25H29Cl2N5O2 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-9-methylpyrimido[5,4-c]quinolin-4-one;dihydrochloride |
| SMILES | COc1ccc(N2CCN(CCn3cnc4c(cnc5ccc(C)cc54)c3=O)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H27N5O2.2ClH/c1-18-3-8-23-21(15-18)24-22(16-26-23)25(31)30(17-27-24)14-11-28-9-12-29(13-10-28)19-4-6-20(32-2)7-5-19;;/h3-8,15-17H,9-14H2,1-2H3;2*1H |
| InChIKey | PQDFARDBWPHVDU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|