C25H24F3N5O — CID 53377137
3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrimido[5,4-c]quinolin-4-one (PubChem CID 53377137) has the molecular formula C25H24F3N5O and a molecular weight of 467.50 g/mol. Its IUPAC name is 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrimido[5,4-c]quinolin-4-one.
| Compound Name | 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrimido[5,4-c]quinolin-4-one |
|---|---|
| PubChem CID | 53377137 |
| Molecular Formula | C25H24F3N5O |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrimido[5,4-c]quinolin-4-one |
| SMILES | O=c1c2cnc3ccccc3c2ncn1CCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H24F3N5O/c26-25(27,28)18-5-3-6-19(15-18)32-13-11-31(12-14-32)9-4-10-33-17-30-23-20-7-1-2-8-22(20)29-16-21(23)24(33)34/h1-3,5-8,15-17H,4,9-14H2 |
| InChIKey | XBSMRHHWAWUWQG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|