C11H12ClN3O6 — CID 53377662
3-[[(2S)-2-amino-2-carboxyethyl]carbamoylamino]-5-chloro-2-hydroxybenzoic acid (PubChem CID 53377662) has the molecular formula C11H12ClN3O6 and a molecular weight of 317.69 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-2-carboxyethyl]carbamoylamino]-5-chloro-2-hydroxybenzoic acid.
| Compound Name | 3-[[(2S)-2-amino-2-carboxyethyl]carbamoylamino]-5-chloro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 53377662 |
| Molecular Formula | C11H12ClN3O6 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-[[(2S)-2-amino-2-carboxyethyl]carbamoylamino]-5-chloro-2-hydroxybenzoic acid |
| SMILES | N[C@@H](CNC(=O)Nc1cc(Cl)cc(C(=O)O)c1O)C(=O)O |
| InChI | InChI=1S/C11H12ClN3O6/c12-4-1-5(9(17)18)8(16)7(2-4)15-11(21)14-3-6(13)10(19)20/h1-2,6,16H,3,13H2,(H,17,18)(H,19,20)(H2,14,15,21)/t6-/m0/s1 |
| InChIKey | ABDTXLCFXMFGLR-LURJTMIESA-N |
| XLogP | 0.28 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|