About 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one
3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one (PubChem CID 53379501) has the molecular formula C18H17NO3S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one |
| PubChem CID | 53379501 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one |
| SMILES | CN=S(C)(=O)c1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-19-23(2,21)15-10-8-13(9-11-15)16-12-22-18(20)17(16)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | YIUDBBNIBASXOU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one?
The IUPAC name of 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one (CID 53379501) is 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one.
What is the SMILES notation for 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one?
The canonical SMILES for 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one is CN=S(C)(=O)c1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1.
What is the InChIKey of 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one?
The InChIKey is YIUDBBNIBASXOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3S/c1-19-23(2,21)15-10-8-13(9-11-15)16-12-22-18(20)17(16)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3.
What are the key properties of 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one?
3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one has a molecular weight of 327.41 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(N,S-dimethylsulfonimidoyl)phenyl]-4-phenyl-2H-furan-5-one is sourced from PubChem (CID 53379501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).