C23H22O11S — CID 101079919
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-(4-methylsulfonylphenyl)-5-oxo-2H-furan-4-yl]phenoxy]oxane-2-carboxylic acid (PubChem CID 101079919) has the molecular formula C23H22O11S and a molecular weight of 506.49 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-(4-methylsulfonylphenyl)-5-oxo-2H-furan-4-yl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-(4-methylsulfonylphenyl)-5-oxo-2H-furan-4-yl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 101079919 |
| Molecular Formula | C23H22O11S |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-(4-methylsulfonylphenyl)-5-oxo-2H-furan-4-yl]phenoxy]oxane-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3)C(=O)OC2)cc1 |
| InChI | InChI=1S/C23H22O11S/c1-35(30,31)14-8-4-11(5-9-14)15-10-32-22(29)16(15)12-2-6-13(7-3-12)33-23-19(26)17(24)18(25)20(34-23)21(27)28/h2-9,17-20,23-26H,10H2,1H3,(H,27,28)/t17-,18-,19+,20-,23+/m0/s1 |
| InChIKey | PVWMFNOEZMRTFY-BPDSMXLESA-N |
| XLogP | -0.17 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|