C10H9FN2O3S — CID 53380109
(4R)-2-(4-fluoro-2-hydroxyanilino)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 53380109) has the molecular formula C10H9FN2O3S and a molecular weight of 256.26 g/mol. Its IUPAC name is (4R)-2-(4-fluoro-2-hydroxyanilino)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4R)-2-(4-fluoro-2-hydroxyanilino)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53380109 |
| Molecular Formula | C10H9FN2O3S |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (4R)-2-(4-fluoro-2-hydroxyanilino)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(Nc2ccc(F)cc2O)=N1 |
| InChI | InChI=1S/C10H9FN2O3S/c11-5-1-2-6(8(14)3-5)12-10-13-7(4-17-10)9(15)16/h1-3,7,14H,4H2,(H,12,13)(H,15,16)/t7-/m0/s1 |
| InChIKey | VWQOZLLRXBPAIE-ZETCQYMHSA-N |
| XLogP | 1.50 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|