C13H16N2O4S — CID 53380304
(4S)-2-(2-hydroxy-4-methoxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid (PubChem CID 53380304) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is (4S)-2-(2-hydroxy-4-methoxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-(2-hydroxy-4-methoxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53380304 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (4S)-2-(2-hydroxy-4-methoxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(NC2=N[C@@H](C(=O)O)C(C)(C)S2)c(O)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-13(2)10(11(17)18)15-12(20-13)14-8-5-4-7(19-3)6-9(8)16/h4-6,10,16H,1-3H3,(H,14,15)(H,17,18)/t10-/m0/s1 |
| InChIKey | TUUQIXVLMUSTIV-JTQLQIEISA-N |
| XLogP | 2.15 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|