C20H13F2N3O3S — CID 53380315
4-(2-fluoro-4-methylphenyl)-2-[(4-fluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 53380315) has the molecular formula C20H13F2N3O3S and a molecular weight of 413.41 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylphenyl)-2-[(4-fluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2-fluoro-4-methylphenyl)-2-[(4-fluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 53380315 |
| Molecular Formula | C20H13F2N3O3S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-(2-fluoro-4-methylphenyl)-2-[(4-fluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cc4c(F)cccn4n3)c2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H13F2N3O3S/c1-10-4-5-11(14(22)7-10)12-9-29-19(17(12)20(27)28)23-18(26)15-8-16-13(21)3-2-6-25(16)24-15/h2-9H,1H3,(H,23,26)(H,27,28) |
| InChIKey | AFGVOPZKKWWOSG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|