C20H26O6 — CID 53380494
tert-butyl (E)-3-[(3S,6S)-6-(2-oxo-2-phenylmethoxyethyl)dioxan-3-yl]prop-2-enoate (PubChem CID 53380494) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is tert-butyl (E)-3-[(3S,6S)-6-(2-oxo-2-phenylmethoxyethyl)dioxan-3-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(3S,6S)-6-(2-oxo-2-phenylmethoxyethyl)dioxan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53380494 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl (E)-3-[(3S,6S)-6-(2-oxo-2-phenylmethoxyethyl)dioxan-3-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@@H]1CC[C@@H](CC(=O)OCc2ccccc2)OO1 |
| InChI | InChI=1S/C20H26O6/c1-20(2,3)24-18(21)12-11-16-9-10-17(26-25-16)13-19(22)23-14-15-7-5-4-6-8-15/h4-8,11-12,16-17H,9-10,13-14H2,1-3H3/b12-11+/t16-,17-/m0/s1 |
| InChIKey | YLNBQVQGOBZODX-YFXCHKOLSA-N |
| XLogP | 3.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|