C24H48O6Si2 — CID 53381051
dimethyl (E,3R,8R)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]dec-5-enedioate (PubChem CID 53381051) has the molecular formula C24H48O6Si2 and a molecular weight of 488.81 g/mol. Its IUPAC name is dimethyl (E,3R,8R)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]dec-5-enedioate.
| Compound Name | dimethyl (E,3R,8R)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]dec-5-enedioate |
|---|---|
| PubChem CID | 53381051 |
| Molecular Formula | C24H48O6Si2 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | dimethyl (E,3R,8R)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]dec-5-enedioate |
| SMILES | COC(=O)C[C@@H](C/C=C/C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O6Si2/c1-23(2,3)31(9,10)29-19(17-21(25)27-7)15-13-14-16-20(18-22(26)28-8)30-32(11,12)24(4,5)6/h13-14,19-20H,15-18H2,1-12H3/b14-13+/t19-,20-/m1/s1 |
| InChIKey | VXPGQCGVYDYKQT-CUVMAEJSSA-N |
| XLogP | 6.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|