C30H60O5Si3 — CID 91696952
methyl (5Z,8Z,14Z)-11,12,19-tris(trimethylsilyloxy)icosa-5,8,14-trienoate (PubChem CID 91696952) has the molecular formula C30H60O5Si3 and a molecular weight of 585.06 g/mol. Its IUPAC name is methyl (5Z,8Z,14Z)-11,12,19-tris(trimethylsilyloxy)icosa-5,8,14-trienoate.
| Compound Name | methyl (5Z,8Z,14Z)-11,12,19-tris(trimethylsilyloxy)icosa-5,8,14-trienoate |
|---|---|
| PubChem CID | 91696952 |
| Molecular Formula | C30H60O5Si3 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | methyl (5Z,8Z,14Z)-11,12,19-tris(trimethylsilyloxy)icosa-5,8,14-trienoate |
| SMILES | COC(=O)CCC/C=C\C/C=C\CC(O[Si](C)(C)C)C(C/C=C\CCCC(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H60O5Si3/c1-27(33-36(3,4)5)23-19-17-18-21-25-29(35-38(9,10)11)28(34-37(6,7)8)24-20-15-13-12-14-16-22-26-30(31)32-2/h12,14-15,18,20-21,27-29H,13,16-17,19,22-26H2,1-11H3/b14-12-,20-15-,21-18- |
| InChIKey | YPPIMIBHDDOACP-LBNYHYCXSA-N |
| XLogP | 9.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|