C10H8FN3O — CID 53381937
3-(3-fluorophenoxy)-5-methyl-1,2,4-triazine (PubChem CID 53381937) has the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. Its IUPAC name is 3-(3-fluorophenoxy)-5-methyl-1,2,4-triazine.
| Compound Name | 3-(3-fluorophenoxy)-5-methyl-1,2,4-triazine |
|---|---|
| PubChem CID | 53381937 |
| Molecular Formula | C10H8FN3O |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(3-fluorophenoxy)-5-methyl-1,2,4-triazine |
| SMILES | Cc1cnnc(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C10H8FN3O/c1-7-6-12-14-10(13-7)15-9-4-2-3-8(11)5-9/h2-6H,1H3 |
| InChIKey | BUEVPKKOMSJYIU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |