C14H13FN2OS — CID 81054224
4-(3-fluorophenoxy)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81054224) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(3-fluorophenoxy)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81054224 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(3-fluorophenoxy)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(Oc2cccc(F)c2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H13FN2OS/c1-8-6-12(13(14(16)19)9(2)17-8)18-11-5-3-4-10(15)7-11/h3-7H,1-2H3,(H2,16,19) |
| InChIKey | ONLCPIISZGTABT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|