C28H14O6 — CID 53382115
9,20-dioxaheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10,12,14(28),15,17,19(27),21,23,25-tridecaene-5,16-dicarboxylic acid (PubChem CID 53382115) has the molecular formula C28H14O6 and a molecular weight of 446.41 g/mol. Its IUPAC name is 9,20-dioxaheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10,12,14(28),15,17,19(27),21,23,25-tridecaene-5,16-dicarboxylic acid.
| Compound Name | 9,20-dioxaheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10,12,14(28),15,17,19(27),21,23,25-tridecaene-5,16-dicarboxylic acid |
|---|---|
| PubChem CID | 53382115 |
| Molecular Formula | C28H14O6 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 9,20-dioxaheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10,12,14(28),15,17,19(27),21,23,25-tridecaene-5,16-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2oc3cccc4c5c(C(=O)O)ccc6oc7ccccc7c(c65)c(c2c1)c34 |
| InChI | InChI=1S/C28H14O6/c29-27(30)13-8-10-19-17(12-13)25-23-15(5-3-7-20(23)34-19)22-16(28(31)32)9-11-21-26(22)24(25)14-4-1-2-6-18(14)33-21/h1-12H,(H,29,30)(H,31,32) |
| InChIKey | NPNQJQBKURWENX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|